Fmoc-his-oh

• CAS: 116611-64-4
• Catalog Number: ACM116611644
• Category: Other Products
• Molecular Weight: 377.39
• Molecular Formula: C₂₁H₁₉N₃O₄
• Synonyms: FMOC-L-HISTIDINE;FMOC-HIS-OH;FMOC-HISTIDINE;N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-L-HISTIDINE;N-α-Fmoc-L-histidine;N-a-Fmoc-L-histidine;N-.ALPHA.-FMOC -L-HISTIDINE;Fmoc-L-His-OH

Custom Q&A

What is the molecular formula of Fmoc-his-oh?

The molecular formula of Fmoc-his-oh is C21H19N3O4.

How is Fmoc-his-oh represented in its canonical SMILES form?

Fmoc-his-oh is represented in its canonical SMILES form as C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CN=CN4)C(=O)O.

What is the IUPAC name of Fmoc-his-oh?

The IUPAC name of Fmoc-his-oh is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-imidazol-5-yl)propanoic acid.

What is the molecular weight of Fmoc-his-oh?

The molecular weight of Fmoc-his-oh is 377.4 g/mol.

How many hydrogen bond donor counts does Fmoc-his-oh have?

Fmoc-his-oh has 3 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Fmoc-his-oh have?

Fmoc-his-oh has 5 hydrogen bond acceptor counts.

How many rotatable bond counts does Fmoc-his-oh have?

Fmoc-his-oh has 7 rotatable bond counts.

What is the exact mass of Fmoc-his-oh?

The exact mass of Fmoc-his-oh is 377.13755610 g/mol.

What is the topological polar surface area of Fmoc-his-oh?

The topological polar surface area of Fmoc-his-oh is 104 ?2.

How many covalently-bonded unit counts does Fmoc-his-oh have?

Fmoc-his-oh has 1 covalently-bonded unit count.