Ethyl trans-2-amino-4-cyclohexene-1-carboxylate hydrochloride

• Catalog Number: ACMA00000593
• Category: Alkenyl
• Molecular Weight: 205.68
• Hazard Statements: H315-H319-H335
• RIDADR: UN 2987 8 / PGII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of Ethyl trans-2-amino-4-cyclohexene-1-carboxylate hydrochloride?

The molecular formula is C9H16ClNO2.

What are the synonyms for Ethyl trans-2-amino-4-cyclohexene-1-carboxylate hydrochloride?

The synonyms are:
trans-Ethyl 6-aminocyclohex-3-enecarboxylate hydrochloride
trans-6-Amino-cyclohex-3-enecarboxylic acid ethyl ester hydrochloride
ethyl (1R,6R)-6-aminocyclohex-3-ene-1-carboxylate;hydrochloride

What is the molecular weight of Ethyl trans-2-amino-4-cyclohexene-1-carboxylate hydrochloride?

The molecular weight is 205.68 g/mol.

What is the IUPAC name of Ethyl trans-2-amino-4-cyclohexene-1-carboxylate hydrochloride?

The IUPAC name is ethyl (1R,6R)-6-aminocyclohex-3-ene-1-carboxylate;hydrochloride.

What is the InChI of Ethyl trans-2-amino-4-cyclohexene-1-carboxylate hydrochloride?

The InChI is InChI=1S/C9H15NO2.ClH/c1-2-12-9(11)7-5-3-4-6-8(7)10;/h3-4,7-8H,2,5-6,10H2,1H3;1H/t7-,8-;/m1./s1.

What is the InChIKey of Ethyl trans-2-amino-4-cyclohexene-1-carboxylate hydrochloride?

The InChIKey is KVUJGOVKWJWXCR-SCLLHFNJSA-N.

What is the canonical SMILES of Ethyl trans-2-amino-4-cyclohexene-1-carboxylate hydrochloride?

The canonical SMILES is CCOC(=O)C1CC=CCC1N.Cl.

What is the hydrogen bond donor count of Ethyl trans-2-amino-4-cyclohexene-1-carboxylate hydrochloride?

The hydrogen bond donor count is 2.

What is the hydrogen bond acceptor count of Ethyl trans-2-amino-4-cyclohexene-1-carboxylate hydrochloride?

The hydrogen bond acceptor count is 3.

Is Ethyl trans-2-amino-4-cyclohexene-1-carboxylate hydrochloride a canonicalized compound?

Yes, it is a canonicalized compound.