Ethyl 2,5-dimethoxybenzoylformate

• Catalog Number: ACMA00002262
• Category: Ethers
• Molecular Weight: 238.24
• Molecular Formula: C₁₂H₁₄O₄S
• Hazard Statements: H302-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of Ethyl 2,5-dimethoxybenzoylformate?

The molecular formula of Ethyl 2,5-dimethoxybenzoylformate is C12H14O5.

What are the synonyms for Ethyl 2,5-dimethoxybenzoylformate?

The synonyms for Ethyl 2,5-dimethoxybenzoylformate are ETHYL 2,5-DIMETHOXYBENZOYLFORMATE, 911047-42-2, ethyl 2-(2,5-dimethoxyphenyl)-2-oxoacetate, MFCD09801405, ETHYL2,5-DIMETHOXYBENZOYLFORMATE.

What is the molecular weight of Ethyl 2,5-dimethoxybenzoylformate?

The molecular weight of Ethyl 2,5-dimethoxybenzoylformate is 238.24 g/mol.

What is the IUPAC name of Ethyl 2,5-dimethoxybenzoylformate?

The IUPAC name of Ethyl 2,5-dimethoxybenzoylformate is ethyl 2-(2,5-dimethoxyphenyl)-2-oxoacetate.

What is the InChI of Ethyl 2,5-dimethoxybenzoylformate?

The InChI of Ethyl 2,5-dimethoxybenzoylformate is InChI=1S/C12H14O5/c1-4-17-12(14)11(13)9-7-8(15-2)5-6-10(9)16-3/h5-7H,4H2,1-3H3.

What is the InChIKey of Ethyl 2,5-dimethoxybenzoylformate?

The InChIKey of Ethyl 2,5-dimethoxybenzoylformate is ZFXDELRBPYIPAX-UHFFFAOYSA-N.

What is the canonical SMILES of Ethyl 2,5-dimethoxybenzoylformate?

The canonical SMILES of Ethyl 2,5-dimethoxybenzoylformate is CCOC(=O)C(=O)C1=C(C=CC(=C1)OC)OC.

What is the CAS number of Ethyl 2,5-dimethoxybenzoylformate?

The CAS number of Ethyl 2,5-dimethoxybenzoylformate is 911047-42-2.

What is the XLogP3-AA value of Ethyl 2,5-dimethoxybenzoylformate?

The XLogP3-AA value of Ethyl 2,5-dimethoxybenzoylformate is 2.

Is Ethyl 2,5-dimethoxybenzoylformate a canonicalized compound?

Yes, Ethyl 2,5-dimethoxybenzoylformate is a canonicalized compound.