What is the molecular formula of ethyl 1-benzyl-4-phenylpiperidine-4-carboxylate?
The molecular formula is C21H25NO2.
What is the molecular weight of ethyl 1-benzyl-4-phenylpiperidine-4-carboxylate?
The molecular weight is 323.4 g/mol.
What is the IUPAC name of ethyl 1-benzyl-4-phenylpiperidine-4-carboxylate?
The IUPAC name is ethyl 1-benzyl-4-phenylpiperidine-4-carboxylate.
What is the InChI of ethyl 1-benzyl-4-phenylpiperidine-4-carboxylate?
The InChI is InChI=1S/C21H25NO2/c1-2-24-20(23)21(19-11-7-4-8-12-19)13-15-22(16-14-21)17-18-9-5-3-6-10-18/h3-12H,2,13-17H2,1H3.
How many hydrogen bond acceptor counts does ethyl 1-benzyl-4-phenylpiperidine-4-carboxylate have?
It has 3 hydrogen bond acceptor counts.
What is the complexity of ethyl 1-benzyl-4-phenylpiperidine-4-carboxylate?
The complexity is 389.
Is ethyl 1-benzyl-4-phenylpiperidine-4-carboxylate a covalently-bonded unit?
Yes, it is a covalently-bonded unit.
What is the XLogP3 value of ethyl 1-benzyl-4-phenylpiperidine-4-carboxylate?
The XLogP3 value is 3.9.
What is the topological polar surface area of ethyl 1-benzyl-4-phenylpiperidine-4-carboxylate?
The topological polar surface area is 29.5 ㎡.
When was ethyl 1-benzyl-4-phenylpiperidine-4-carboxylate last modified?
It was last modified on 2023-12-30.