Enalapril diketopiperazine

CAS

115729-52-7

Catalog Number

ACM115729527

Category

Other Products

Molecular Weight

358.43144

Molecular Formula

C₂₀H₂₆N₂O₄

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

2-[1,4-Dioxo-3-methyloctahydropyrrolo[1,2-a]pyrazine-2-yl]-4-phenylbutyric acid ethyl ester;4-Phenyl-2-[(1,2,3,4,6,7,8,8a-octahydro-3-methyl-1,4-dioxopyrrolo[1,2-a]pyrazin)-2-yl]butanoic acid ethyl ester;Enalapril diketopiperazine;(αS,3S,8aS)-Hexahydro-3-Methyl-1,4-dioxo-α-(2-phenylethyl)pyrrolo[1,2-a]pyrazine-2(1H)-acetic Acid Ethyl Ester;[3S-[2(R*),3α,8aβ]]-Hexahydro-3-Methyl-1,4-dioxo-α-(2-phenylethyl)pyrrolo[1,2-a]pyrazine-2(1H)-acetic Acid Ethyl Ester;Enalapril DKP;Enalapril IMpurity-D(EP);Enalapril EP IMpurity D

What is the molecular formula of Enalapril diketopiperazine?

The molecular formula of Enalapril diketopiperazine is C20H26N2O4.

What are some synonyms for Enalapril diketopiperazine?

Some synonyms for Enalapril diketopiperazine are Enalapril DKP and Enalapril impurity D.

What is the molecular weight of Enalapril diketopiperazine?

The molecular weight of Enalapril diketopiperazine is 358.4 g/mol.

What is the IUPAC name of Enalapril diketopiperazine?

The IUPAC name of Enalapril diketopiperazine is ethyl (2S)-2-[(3S,8aS)-3-methyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl]-4-phenylbutanoate.

What is the InChIKey of Enalapril diketopiperazine?

The InChIKey of Enalapril diketopiperazine is BMZHNHHJUGMMLV-XIRDDKMYSA-N.

What is the Canonical SMILES of Enalapril diketopiperazine?

The Canonical SMILES of Enalapril diketopiperazine is CCOC(=O)C(CCC1=CC=CC=C1)N2C(C(=O)N3CCCC3C2=O).

What is the CAS number of Enalapril diketopiperazine?

The CAS number of Enalapril diketopiperazine is 115729-52-7.

What is the XLogP3-AA value of Enalapril diketopiperazine?

The XLogP3-AA value of Enalapril diketopiperazine is 2.6.

How many hydrogen bond acceptors does Enalapril diketopiperazine have?

Enalapril diketopiperazine has 4 hydrogen bond acceptors.

How many defined atom stereocenters does Enalapril diketopiperazine have?

Enalapril diketopiperazine has 3 defined atom stereocenters.