(E)-ethyl 3-(2-bromophenyl)acrylate

• CAS: 99134-25-5
• Catalog Number: ACM99134255
• Category: Bromine Series

Custom Q&A

What is the molecular formula of (E)-ethyl 3-(2-bromophenyl) acrylate?

The molecular formula is C11H11BrO2.

What is the molecular weight of (E)-ethyl 3-(2-bromophenyl) acrylate?

The molecular weight is 255.11 g/mol.

What is the IUPAC name of (E)-ethyl 3-(2-bromophenyl) acrylate?

The IUPAC name is ethyl (E)-3-(2-bromophenyl)prop-2-enoate.

What is the InChI of (E)-ethyl 3-(2-bromophenyl) acrylate?

The InChI is InChI=1S/C11H11BrO2/c1-2-14-11(13)8-7-9-5-3-4-6-10(9)12/h3-8H,2H2,1H3/b8-7+.

What is the InChIKey of (E)-ethyl 3-(2-bromophenyl) acrylate?

The InChIKey is OVVAHDSHDPZGMY-BQYQJAHWSA-N.

What is the canonical SMILES of (E)-ethyl 3-(2-bromophenyl) acrylate?

The canonical SMILES is CCOC(=O)C=CC1=CC=CC=C1Br.

What is the isomeric SMILES of (E)-ethyl 3-(2-bromophenyl) acrylate?

The isomeric SMILES is CCOC(=O)/C=C/C1=CC=CC=C1Br.

How many hydrogen bond donor counts does (E)-ethyl 3-(2-bromophenyl) acrylate have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does (E)-ethyl 3-(2-bromophenyl) acrylate have?

It has 2 hydrogen bond acceptor counts.

How many rotatable bond counts does (E)-ethyl 3-(2-bromophenyl) acrylate have?

It has 4 rotatable bond counts.