CAS
29512-49-0 Purity
---
29512-49-0 Purity
---
![4-[(5S,7S,8S,10S,13R,17R)-3,7,12-Trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid](https://resource.alfa-chemistry.com/structure/2955-27-3.gif)
Inquiry Basket
Dodecenylsuccinic acid
CAS
29658-97-7
Catalog Number
ACM29658977
Category
Other Products
Molecular Weight
0
Molecular Formula
C16H28O4
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
Dodelenyl Succinic Acid;Butanedioic acid, dodecenyl-;Dodecene succinic acid;dodecenyl-Butanedioic acid;T 746
What is the PubChem CID for Dodecenylsuccinic acid?
The PubChem CID for Dodecenylsuccinic acid is 5463970.
What is the molecular formula of Dodecenylsuccinic acid?
The molecular formula of Dodecenylsuccinic acid is C16H28O4.
What is the molecular weight of Dodecenylsuccinic acid?
The molecular weight of Dodecenylsuccinic acid is 284.39 g/mol.
What is the IUPAC name of Dodecenylsuccinic acid?
The IUPAC name of Dodecenylsuccinic acid is 2-[(E)-dodec-1-enyl]butanedioic acid.
What is the InChI of Dodecenylsuccinic acid?
The InChI of Dodecenylsuccinic acid is InChI=1S/C16H28O4/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(19)20)13-15(17)18/h11-12,14H,2-10,13H2,1H3,(H,17,18)(H,19,20)/b12-11+.
What is the InChIKey of Dodecenylsuccinic acid?
The InChIKey of Dodecenylsuccinic acid is QDCPNGVVOWVKJG-VAWYXSNFSA-N.
What is the canonical SMILES of Dodecenylsuccinic acid?
The canonical SMILES of Dodecenylsuccinic acid is CCCCCCCCCC=CC(CC(=O)O)C(=O)O.
What is the CAS number of Dodecenylsuccinic acid?
The CAS number of Dodecenylsuccinic acid is 29658-97-7.
What is the XLogP3-AA value of Dodecenylsuccinic acid?
The XLogP3-AA value of Dodecenylsuccinic acid is 5.1.
How many hydrogen bond acceptors does Dodecenylsuccinic acid have?
Dodecenylsuccinic acid has 4 hydrogen bond acceptors.
Recommended Products
