Disperse Violet 63

CAS

64294-88-8

Catalog Number

ACM64294888

Category

Disperse Dyes

Molecular Weight

518.31

Molecular Formula

C₂₀H₁₉IN₆O₃

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

Acetamide, 2-chloro-N-2-(2-cyano-4-nitrophenyl)azo-5-(diethylamino)phenyl-;Violet 3RL;C.I.Disperse Violet 63;Dispersol Violet C-3R;Foron Brilliant Violet S-3RL

What is the molecular formula of Disperse Violet 63?

The molecular formula of Disperse Violet 63 is C19H19ClN6O3.

What is the molecular weight of Disperse Violet 63?

The molecular weight of Disperse Violet 63 is 414.8 g/mol.

What is the IUPAC name of Disperse Violet 63?

The IUPAC name of Disperse Violet 63 is 2-chloro-N-[2-[(2-cyano-4-nitrophenyl)diazenyl]-5-(diethylamino)phenyl]acetamide.

What is the InChI of Disperse Violet 63?

The InChI of Disperse Violet 63 is InChI=1S/C19H19ClN6O3/c1-3-25(4-2)14-5-8-17(18(10-14)22-19(27)11-20)24-23-16-7-6-15(26(28)29)9-13(16)12-21/h5-10H,3-4,11H2,1-2H3,(H,22,27).

What is the InChIKey of Disperse Violet 63?

The InChIKey of Disperse Violet 63 is CULIYQPRUGMRRT-UHFFFAOYSA-N.

What is the canonical SMILES of Disperse Violet 63?

The canonical SMILES of Disperse Violet 63 is CCN(CC)C1=CC(=C(C=C1)N=NC2=C(C=C(C=C2)[N+](=O)[O-])C#N)NC(=O)CCl.

What is the CAS number of Disperse Violet 63?

The CAS number of Disperse Violet 63 is 64294-88-8.

What is the European Community (EC) number of Disperse Violet 63?

The European Community (EC) number of Disperse Violet 63 is 613-570-6.

What is the XLogP3-AA value of Disperse Violet 63?

The XLogP3-AA value of Disperse Violet 63 is 3.9.

Is Disperse Violet 63 a canonicalized compound?

Yes, Disperse Violet 63 is a canonicalized compound.