(Dimethylamino)(4-fluorophenyl)acetic acid hydrochloride

• Catalog Number: ACMA00001669
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 233.67
• Molecular Formula: C₁₀H₁₀FNO₃S
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (Dimethylamino)(4-fluorophenyl)acetic acid hydrochloride?

The molecular formula is C10H13ClFNO2.

What is the molecular weight of (Dimethylamino)(4-fluorophenyl)acetic acid hydrochloride?

The molecular weight is 233.67 g/mol.

What is the IUPAC name of (Dimethylamino)(4-fluorophenyl)acetic acid hydrochloride?

The IUPAC name is 2-(dimethylamino)-2-(4-fluorophenyl)acetic acid;hydrochloride.

What is the InChI of (Dimethylamino)(4-fluorophenyl)acetic acid hydrochloride?

The InChI is InChI=1S/C10H12FNO2.ClH/c1-12(2)9(10(13)14)7-3-5-8(11)6-4-7;/h3-6,9H,1-2H3,(H,13,14);1H.

What is the InChIKey of (Dimethylamino)(4-fluorophenyl)acetic acid hydrochloride?

The InChIKey is QGJCHMPPRDFDBX-UHFFFAOYSA-N.

What is the Canonical SMILES of (Dimethylamino)(4-fluorophenyl)acetic acid hydrochloride?

The Canonical SMILES is CN(C)C(C1=CC=C(C=C1)F)C(=O)O.Cl.

What is the CAS number of (Dimethylamino)(4-fluorophenyl)acetic acid hydrochloride?

The CAS number is 1255716-97-2.

What is the hydrogen bond donor count of (Dimethylamino)(4-fluorophenyl)acetic acid hydrochloride?

The hydrogen bond donor count is 2.

What is the hydrogen bond acceptor count of (Dimethylamino)(4-fluorophenyl)acetic acid hydrochloride?

The hydrogen bond acceptor count is 4.

What is the topological polar surface area of (Dimethylamino)(4-fluorophenyl)acetic acid hydrochloride?

The topological polar surface area is 40.5Ų.