Dikegulac sodium

• CAS: 52508-35-7
• Catalog Number: ACM52508357
• Category: Other Products
• Molecular Weight: 296.25
• Molecular Formula: C₁₂H₁₇NaO₇
• Synonyms: DIKEGULAC NA;DIKEGULAC SODIUM;2,3:4,6-DI-O-ISOPROPYLIDEN-2-OXO-L-GULONIC ACID SODIUM SALT;2,3:4,6-bis-o-(1-methylethylidene)-alpha-l-xylo-2-hexulofuranosonicacisod;2,3:4,6-di-o-isopropylidene-2-keto-l-*gulonicaci;atrinal;cutlass;natrium-2,3:4,6-di-o-isopropyliden-2-keto-l-gulonat

Custom Q&A

What is the molecular formula of Dikegulac sodium?

The molecular formula of Dikegulac sodium is C12H17NaO7.

When was Dikegulac sodium created and modified?

Dikegulac sodium was created on 2008-02-05 and modified on 2023-12-30.

What is the IUPAC Name of Dikegulac sodium?

The IUPAC Name of Dikegulac sodium is sodium;(1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.0 2,6 ]dodecane-6-carboxylate.

What is the molecular weight of Dikegulac sodium?

The molecular weight of Dikegulac sodium is 296.25 g/mol.

What is the Canonical SMILES of Dikegulac sodium?

The Canonical SMILES of Dikegulac sodium is CC1(OCC2C(O1)C3C(O2)(OC(O3)(C)C)C(=O)[O-]).[Na+].

What is the UNII of Dikegulac sodium?

The UNII of Dikegulac sodium is 3M4815901H.

How many hydrogen bond acceptors does Dikegulac sodium have?

Dikegulac sodium has 7 hydrogen bond acceptors.

What is the topological polar surface area of Dikegulac sodium?

The topological polar surface area of Dikegulac sodium is 86.3 Ų.

How many heavy atoms does Dikegulac sodium contain?

Dikegulac sodium contains 20 heavy atoms.

How many defined atom stereocenters does Dikegulac sodium have?

Dikegulac sodium has 4 defined atom stereocenters.