CAS
337463-88-4 Purity
---
337463-88-4 Purity
---
![(6a,11b,16a)-6-Fluoro-11,21-dihydroxy-16,17-[(1-methylethylidene)bis(oxy)]-pregna-1,4-diene-3,20-dione](https://resource.alfa-chemistry.com/structure/3385-03-3.gif)
Inquiry Basket
Diethyl methylidenemalonate
CAS
3377-20-6
Catalog Number
ACM3377206
Category
Other Products
Molecular Weight
0
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
diethyl methylidenemalonate;Diethyl 2-methylenemalonate;Diethyl ethylene-1,1-dicarboxylate;Diethyl methylenemalonate;Methylenemalonic acid diethyl ester;Methylenepropanedioic acid diethyl ester;Propanedioic acid, 2-Methylene-, 1,3-diethyl ester;Propanedioic acid,2-Methylene-, 1,3-diethyl este
What is the PubChem CID of the compound?
The PubChem CID of the compound is 95118.
What is the molecular formula of the compound?
The molecular formula of the compound is C8H12O4.
What is the molecular weight of the compound?
The molecular weight of the compound is 172.18 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is diethyl 2-methylidenepropanedioate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H12O4/c1-4-11-7(9)6(3)8(10)12-5-2/h3-5H2,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is BQHDXNZNSPVVKB-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CCOC(=O)C(=C)C(=O)OCC.
What is the CAS number of the compound?
The CAS number of the compound is 3377-20-6.
What is the EC number of the compound?
The EC number of the compound is 815-045-9.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 1.5.
Recommended Products
![6-Bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one](https://resource.alfa-chemistry.com/structure/337463-88-4.gif)
