Di-N-butyldimethacrylatetin

• CAS: 15257-25-7
• Catalog Number: ACM15257257
• Category: Organic Tin
• Molecular Weight: 403.1
• Molecular Formula: C₁₆H₂₈O₄Sn
• Synonyms: DI-N-BUTYLDIMETHACRYLATETIN;dibutylbis(methacryloyloxy)stannane;Di-N-ButyldiMETHacrylate;Dibutylbis[(2-methyl-1-oxo-2-propenyl)oxy]stannane;Einecs 239-295-8

Custom Q&A

What is the molecular formula of Di-N-butyldimethacrylatetin?

The molecular formula of Di-N-butyldimethacrylatetin is C16H28O4Sn.

When was Di-N-butyldimethacrylatetin first created in PubChem?

Di-N-butyldimethacrylatetin was first created in PubChem on August 23, 2007.

What is the molecular weight of Di-N-butyldimethacrylatetin?

The molecular weight of Di-N-butyldimethacrylatetin is 403.1 g/mol.

What is the IUPAC name of Di-N-butyldimethacrylatetin?

The IUPAC name of Di-N-butyldimethacrylatetin is [dibutyl(2-methylprop-2-enoyloxy)stannyl] 2-methylprop-2-enoate.

What is the InChIKey of Di-N-butyldimethacrylatetin?

The InChIKey of Di-N-butyldimethacrylatetin is UCJOBZKBTWHHRK-UHFFFAOYSA-L.

What is the Canonical SMILES of Di-N-butyldimethacrylatetin?

The Canonical SMILES of Di-N-butyldimethacrylatetin is CCCC[Sn](CCCC)(OC(=O)C(=C)C)OC(=O)C(=C)C.

What is the CAS number for Di-N-butyldimethacrylatetin?

The CAS number for Di-N-butyldimethacrylatetin is 15257-25-7.

How many hydrogen bond acceptor counts are there in Di-N-butyldimethacrylatetin?

There are 4 hydrogen bond acceptor counts in Di-N-butyldimethacrylatetin.

What is the exact mass of Di-N-butyldimethacrylatetin?

The exact mass of Di-N-butyldimethacrylatetin is 404.100962 g/mol.

Is Di-N-butyldimethacrylatetin considered as a canonicalized compound in PubChem?

Yes, Di-N-butyldimethacrylatetin is considered as a canonicalized compound in PubChem.