Deferoxamine

• CAS: 70-51-9
• Catalog Number: ACM70519
• Category: Other Products
• Molecular Weight: 560.68
• Molecular Formula: C₂₅H₄₈N₆O₈
• Synonyms: 1-amino-6,17-dihydroxy-7,10,18,21-tetraoxo-27-(n-acetylhydroxylamino)-6,11,17,;22-tetraazaheptaeicosane;3,9,14,20,25-pentaazatriacontane-2,10,13,21,24-pentone,30-amino-3,14,25-trih;3,9,14,20,25-pentaazatriacontane-2,10,13,21,24-pentone,30-amino-3,14,25-trihyd;30-amino-3,14,25-trihydroxy-3,9,14,20,25-pentaazatriacontane-2,10,13,21,24-p;30-amino-3,14,25-trihydroxy-3,9,14,20,25-pentaazatriacontane-2,10,13,21,24-pen;acetamido)pentyl]carbamoyl]propionohydroxamicacid;ba-29837

Custom Q&A

What is the molecular formula of Deferoxamine?

The molecular formula of Deferoxamine is C25H48N6O8.

What is the molecular weight of Deferoxamine?

The molecular weight of Deferoxamine is 560.7 g/mol.

What is the synonym for Deferoxamine?

One of the synonyms for Deferoxamine is Desferrioxamine B.

What is the acyclic desferrioxamine native to Streptomyces pilosus?

Desferrioxamine B is the acyclic desferrioxamine native to Streptomyces pilosus.

How is Desferrioxamine B biosynthesized in Streptomyces pilosus?

Desferrioxamine B is biosynthesized by the DesABCD enzyme cluster in Streptomyces pilosus.

What is the role of Desferrioxamine B?

Desferrioxamine B has roles as an iron chelator, a siderophore, a ferroptosis inhibitor, and a bacterial metabolite.

What is the IUPAC Name of Deferoxamine?

The IUPAC Name of Deferoxamine is N-[5-[[4-[5-[acetyl(hydroxy)amino]pentylamino]-4-oxobutanoyl]-hydroxyamino]pentyl]-N'-(5-aminopentyl)-N'-hydroxybutanediamide.

What is the InChIKey of Deferoxamine?

The InChIKey of Deferoxamine is UBQYURCVBFRUQT-UHFFFAOYSA-N.

What is the Canonical SMILES representation of Deferoxamine?

The Canonical SMILES representation of Deferoxamine is CC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCN)O)O)O.

What is the CAS number for Deferoxamine?

The CAS number for Deferoxamine is 70-51-9.