Cyclo(arg-gly-asp-D-phe-lys)

• CAS: 161552-03-0
• Catalog Number: ACM161552030
• Category: Other Products
• Molecular Weight: 603.67
• Molecular Formula: C₂₇H₄₁N₉O₇
• Synonyms: CYCLO(-RGDFK);CYCLO (ARG-GLY-ASP-D-PHE-LYS);cyclo (Arg-Gly-Asp-Phe-Lys);c(RGDfK);Cyclic RGDFK peptide;Cyclo(L-arginylglycyl-L-alpha-aspartyl-D-phenylalanyl-L-lysyl);Cyclo(-Arg-Gly-Asp-D-Phe-Lys); Trifluoroacetate salt
• Melting Point: 191°C (decomposition)

Custom Q&A

What is the molecular formula of Cyclo(arg-gly-asp-D-phe-lys)?

The molecular formula of Cyclo(arg-gly-asp-D-phe-lys) is C27H41N9O7.

What is the molecular weight of Cyclo(arg-gly-asp-D-phe-lys)?

The molecular weight of Cyclo(arg-gly-asp-D-phe-lys) is 603.7 g/mol.

What is the IUPAC name of Cyclo(arg-gly-asp-D-phe-lys)?

The IUPAC name of Cyclo(arg-gly-asp-D-phe-lys) is 2-[(2S,5R,8S,11S)-8-(4-aminobutyl)-5-benzyl-11-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15-pentaoxo-1,4,7,10,13-pentazacyclopentadec-2-yl]acetic acid.

What is the InChIKey of Cyclo(arg-gly-asp-D-phe-lys)?

The InChIKey of Cyclo(arg-gly-asp-D-phe-lys) is NVHPXYIRNJFKTE-HAGHYFMRSA-N.

What is the Canonical SMILES of Cyclo(arg-gly-asp-D-phe-lys)?

The Canonical SMILES of Cyclo(arg-gly-asp-D-phe-lys) is C1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CCCN=C(N)N)CCCCN)CC2=CC=CC=C2)CC(=O)O.

What is the CAS number of Cyclo(arg-gly-asp-D-phe-lys)?

The CAS number of Cyclo(arg-gly-asp-D-phe-lys) is 161552-03-0.

How many hydrogen bond donor counts are there in Cyclo(arg-gly-asp-D-phe-lys)?

There are 9 hydrogen bond donor counts in Cyclo(arg-gly-asp-D-phe-lys).

What is the topological polar surface area of Cyclo(arg-gly-asp-D-phe-lys)?

The topological polar surface area of Cyclo(arg-gly-asp-D-phe-lys) is 273 Å2.

How many defined atom stereocenters are there in Cyclo(arg-gly-asp-D-phe-lys)?

There are 4 defined atom stereocenters in Cyclo(arg-gly-asp-D-phe-lys).

What is the complexity value of Cyclo(arg-gly-asp-D-phe-lys)?

The complexity value of Cyclo(arg-gly-asp-D-phe-lys) is 1010.