Cx-3543

• CAS: 865311-47-3
• Catalog Number: ACM865311473
• Category: Other Products
• Molecular Weight: 604.6733232
• Molecular Formula: C₃₅H₃₃FN₆O₃
• Synonyms: CX-3543;2-(4-((R)-1-Methylpyrrolidin-2-yl)butanoyl)-6-(3-(pyrazin-2-yl)pyrrolidin-1-yl)-3H-benzo[b]pyrido[3,2,1-kl]phenoxazin-3-one;5-Fluoro-N-[2-[(2S)-1-methyl-2-pyrrolidinyl]ethyl]-3-oxo-6-[3-(2-pyrazinyl)-1-pyrrolidinyl]-3H-benzo[b]pyrido[3,2,1-kl]phenoxazine-2-carboxamide;Itarnafloxin;Quarfloxacin;Quarfloxin (CX-3543);Quarfloxin
• Density: 1.44

Custom Q&A

What is the molecular formula of Itarnafloxin?

The molecular formula of Itarnafloxin is C35H33FN6O3.

What is another name for Itarnafloxin?

Itarnafloxin is also known as Quarfloxin.

What is the molecular weight of Itarnafloxin?

The molecular weight of Itarnafloxin is 604.7 g/mol.

What is the IUPAC name of Itarnafloxin?

The IUPAC name of Itarnafloxin is 15-fluoro-N-[2-[(2S)-1-methylpyrrolidin-2-yl]ethyl]-18-oxo-14-(3-pyrazin-2-ylpyrrolidin-1-yl)-12-oxa-1-azapentacyclo[11.7.1.0 2,11 .0 4,9 .0 17,21 ]henicosa-2,4,6,8,10,13(21),14,16,19-nonaene-19-carboxamide.

What is the InChIKey of Itarnafloxin?

The InChIKey of Itarnafloxin is WOQIDNWTQOYDLF-CGAIIQECSA-N.

What is the canonical SMILES representation of Itarnafloxin?

The canonical SMILES representation of Itarnafloxin is CN1CCCC1CCNC(=O)C2=CN3C4=CC5=CC=CC=C5C=C4OC6=C3C(=CC(=C6N7CCC(C7)C8=NC=CN=C8)F)C2=O.

How many hydrogen bond donor counts does Itarnafloxin have?

Itarnafloxin has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does Itarnafloxin have?

Itarnafloxin has 9 hydrogen bond acceptor counts.

What is the topological polar surface area of Itarnafloxin?

The topological polar surface area of Itarnafloxin is 90.9 Å^2.

What is the formal charge of Itarnafloxin?

The formal charge of Itarnafloxin is 0.