CAS
997-95-5 Purity
96%
997-95-5 Purity
96%
Inquiry Basket
Ethanone,1-(2-methyl-2-azabicyclo[2.2.2]oct-5-en-6-yl)-(9ci)
CAS
99803-20-0
Catalog Number
ACM99803200
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of Ethanone,1-(2-methyl-2-azabicyclo[2.2.2]oct-5-en-6-yl)-(9ci)?
The molecular formula is C10H15NO.
When was Ethanone,1-(2-methyl-2-azabicyclo[2.2.2]oct-5-en-6-yl)-(9ci) created?
It was created on February 16, 2015.
What is the molecular weight of Ethanone,1-(2-methyl-2-azabicyclo[2.2.2]oct-5-en-6-yl)-(9ci)?
The molecular weight is 165.23 g/mol.
What is the IUPAC Name of Ethanone,1-(2-methyl-2-azabicyclo[2.2.2]oct-5-en-6-yl)-(9ci)?
The IUPAC Name is 1-[(1S,4R)-2-methyl-2-azabicyclo[2.2.2]oct-5-en-6-yl]ethanone.
What is the InChI of Ethanone,1-(2-methyl-2-azabicyclo[2.2.2]oct-5-en-6-yl)-(9ci)?
The InChI is InChI=1S/C10H15NO/c1-7(12)9-5-8-3-4-10(9)11(2)6-8/h5,8,10H,3-4,6H2,1-2H3/t8-,10+/m1/s1.
How many heavy atoms are there in Ethanone,1-(2-methyl-2-azabicyclo[2.2.2]oct-5-en-6-yl)-(9ci)?
There are 12 heavy atoms in Ethanone,1-(2-methyl-2-azabicyclo[2.2.2]oct-5-en-6-yl)-(9ci).
What is the XLogP3-AA value of Ethanone,1-(2-methyl-2-azabicyclo[2.2.2]oct-5-en-6-yl)-(9ci)?
The XLogP3-AA value is 0.7.
How many hydrogen bond acceptors are there in Ethanone,1-(2-methyl-2-azabicyclo[2.2.2]oct-5-en-6-yl)-(9ci)?
There are 2 hydrogen bond acceptors.
Is Ethanone,1-(2-methyl-2-azabicyclo[2.2.2]oct-5-en-6-yl)-(9ci) a canonicalized compound?
Yes, it is a canonicalized compound.
What is the exact mass of Ethanone,1-(2-methyl-2-azabicyclo[2.2.2]oct-5-en-6-yl)-(9ci)?
The exact mass is 165.115364102 g/mol.
Recommended Products
