99886-31-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H14.
The molecular weight of the compound is 110.20 g/mol.
The IUPAC name of the compound is (5E)-4-methylhepta-1,5-diene.
The InChI of the compound is InChI=1S/C8H14/c1-4-6-8(3)7-5-2/h4-5,7-8H,1,6H2,2-3H3/b7-5+.
The InChIKey of the compound is ITKKJSFRRSLPHX-FNORWQNLSA-N.
The canonical SMILES of the compound is CC=CC(C)CC=C.
The isomeric SMILES of the compound is C/C=C/C(C)CC=C.
The CAS number of the compound is 998-94-7.
The XLogP3-AA value of the compound is 3.
Yes, the compound is canonicalized.