99768-12-4 Purity
98%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2,5-Dimethyl-1-piperazineethanol is C8H18N2O.
2,5-Dimethyl-1-piperazineethanol was created on March 26, 2005.
The molecular weight of 2,5-Dimethyl-1-piperazineethanol is 158.24 g/mol.
The InChI of 2,5-Dimethyl-1-piperazineethanol is InChI=1S/C8H18N2O/c1-7-6-10(3-4-11)8(2)5-9-7/h7-9,11H,3-6H2,1-2H3.
There are 2 hydrogen bond donor counts in 2,5-Dimethyl-1-piperazineethanol.
The exact mass of 2,5-Dimethyl-1-piperazineethanol is 158.141913202 g/mol.
Yes, 2,5-Dimethyl-1-piperazineethanol is a canonicalized compound.
There are 2 rotatable bond counts in 2,5-Dimethyl-1-piperazineethanol.
The topological polar surface area of 2,5-Dimethyl-1-piperazineethanol is 35.5 Ų.
There are 3 hydrogen bond acceptor counts in 2,5-Dimethyl-1-piperazineethanol.