99-76-1 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2-(4-Ethoxyphenoxy)propionic acid is C11H14O4.
2-(4-Ethoxyphenoxy)propionic acid was created on September 11, 2005.
The molecular weight of 2-(4-Ethoxyphenoxy)propionic acid is 210.23 g/mol.
The InChI of 2-(4-Ethoxyphenoxy)propionic acid is InChI=1S/C11H14O4/c1-3-14-9-4-6-10(7-5-9)15-8(2)11(12)13/h4-8H,3H2,1-2H3,(H,12,13).
2-(4-Ethoxyphenoxy)propionic acid has 1 hydrogen bond donor count.
The topological polar surface area of 2-(4-Ethoxyphenoxy)propionic acid is 55.8 Ų.
2-(4-Ethoxyphenoxy)propionic acid has 5 rotatable bond count.
Yes, 2-(4-Ethoxyphenoxy)propionic acid is considered as a canonicalized compound.
The XLogP3 value of 2-(4-Ethoxyphenoxy)propionic acid is 2.
2-(4-Ethoxyphenoxy)propionic acid has 0 defined atom stereocenter count.