What is the molecular formula of Benzenemethanol,a-ethynyl-a-(trifluoromethyl)?
The molecular formula of Benzenemethanol,a-ethynyl-a-(trifluoromethyl) is C10H7F3O.
When was the structure of Benzenemethanol,a-ethynyl-a-(trifluoromethyl) created and modified?
The structure was created on July 19, 2005, and modified on December 30, 2023.
What is the IUPAC Name of Benzenemethanol,a-ethynyl-a-(trifluoromethyl)?
The IUPAC Name is 1,1,1-trifluoro-2-phenylbut-3-yn-2-ol.
What is the InChIKey of Benzenemethanol,a-ethynyl-a-(trifluoromethyl)?
The InChIKey is WWIJKFJKIOQDKI-UHFFFAOYSA-N.
What is the Canonical SMILES of Benzenemethanol,a-ethynyl-a-(trifluoromethyl)?
The Canonical SMILES is C#CC(C1=CC=CC=C1)(C(F)(F)F)O.
What is the Molecular Weight of Benzenemethanol,a-ethynyl-a-(trifluoromethyl)?
The Molecular Weight is 200.16 g/mol.
How many Hydrogen Bond Donor Count does Benzenemethanol,a-ethynyl-a-(trifluoromethyl) have?
It has 1 Hydrogen Bond Donor Count.
What is the Topological Polar Surface Area of Benzenemethanol,a-ethynyl-a-(trifluoromethyl)?
The Topological Polar Surface Area is 20.2 ?2.
Does Benzenemethanol,a-ethynyl-a-(trifluoromethyl) have any Defined Atom Stereocenter Count?
No, it does not have any Defined Atom Stereocenter Count.
Is the Compound Is Canonicalized for Benzenemethanol,a-ethynyl-a-(trifluoromethyl)?
Yes, the Compound Is Canonicalized for Benzenemethanol,a-ethynyl-a-(trifluoromethyl).