996-97-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H7N3O2S.
The IUPAC name of the compound is 3-methyl-6-nitro-1,3-benzothiazol-2-imine.
The InChI of the compound is InChI=1S/C8H7N3O2S/c1-10-6-3-2-5(11(12)13)4-7(6)14-8(10)9/h2-4,9H,1H3.
The InChIKey of the compound is YNEYOQIUYCTUST-UHFFFAOYSA-N.
The canonical SMILES of the compound is CN1C2=C(C=C(C=C2)[N+](=O)[O-])SC1=N.
The molecular weight of the compound is 209.23 g/mol.
There is 1 hydrogen bond donor count in the compound.
There are 4 hydrogen bond acceptor counts in the compound.
There are 0 rotatable bond counts in the compound.
Yes, the compound is canonicalized.