99593-01-8 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 4-ethynyl-2-methylphenol.
The molecular formula of the compound is C9H8O.
The molecular weight of the compound is 132.16 g/mol.
The InChI of the compound is InChI=1S/C9H8O/c1-3-8-4-5-9(10)7(2)6-8/h1,4-6,10H,2H3.
The InChIKey of the compound is ZGWMWUAKTFHAKF-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=C(C=CC(=C1)C#C)O.
The CAS number of the compound is 99595-76-3.
The XLogP3 value of the compound is 2.2.
The compound has 1 hydrogen bond donor count.
The compound has 1 hydrogen bond acceptor count.