99-4-7 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H10IN.
The molecular weight of the compound is 247.08 g/mol.
The IUPAC name of the compound is 2-ethyl-4-iodoaniline.
The InChI of the compound is InChI=1S/C8H10IN/c1-2-6-5-7(9)3-4-8(6)10/h3-5H,2,10H2,1H3.
The InChIKey of the compound is PLKZGDYLTZBAEH-UHFFFAOYSA-N.
The Canonical SMILES of the compound is CCC1=C(C=CC(=C1)I)N.
The CAS number of the compound is 99471-67-7.
The XLogP3-AA value of the compound is 2.7.
The compound has 1 hydrogen bond donor count.
The compound has 1 hydrogen bond acceptor count.