CAS
993-70-4 Purity
---
993-70-4 Purity
---
Inquiry Basket
2-Phenylthiazolidine-4-carboxylic acid methyl ester
CAS
99380-81-1
Catalog Number
ACM99380811
Category
Other Products
Molecular Weight
223.29
Molecular Formula
C11H13NO2S
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
METHYL 2-PHENYLTHIAZOLIDINE-4-CARBOXYLATE
What is the molecular formula of 2-Phenylthiazolidine-4-carboxylic acid methyl ester?
The molecular formula of 2-Phenylthiazolidine-4-carboxylic acid methyl ester is C11H13NO2S.
What is the molecular weight of 2-Phenylthiazolidine-4-carboxylic acid methyl ester?
The molecular weight of 2-Phenylthiazolidine-4-carboxylic acid methyl ester is 223.29 g/mol.
What is the IUPAC name of 2-Phenylthiazolidine-4-carboxylic acid methyl ester?
The IUPAC name of 2-Phenylthiazolidine-4-carboxylic acid methyl ester is methyl 2-phenyl-1,3-thiazolidine-4-carboxylate.
What is the InChI code of 2-Phenylthiazolidine-4-carboxylic acid methyl ester?
The InChI code of 2-Phenylthiazolidine-4-carboxylic acid methyl ester is InChI=1S/C11H13NO2S/c1-14-11(13)9-7-15-10(12-9)8-5-3-2-4-6-8/h2-6,9-10,12H,7H2,1H3.
What is the Canonical SMILES of 2-Phenylthiazolidine-4-carboxylic acid methyl ester?
The Canonical SMILES of 2-Phenylthiazolidine-4-carboxylic acid methyl ester is COC(=O)C1CSC(N1)C2=CC=CC=C2.
What is the XLogP3-AA value of 2-Phenylthiazolidine-4-carboxylic acid methyl ester?
The XLogP3-AA value of 2-Phenylthiazolidine-4-carboxylic acid methyl ester is 1.8.
How many hydrogen bond donor counts are present in 2-Phenylthiazolidine-4-carboxylic acid methyl ester?
There is 1 hydrogen bond donor count in 2-Phenylthiazolidine-4-carboxylic acid methyl ester.
How many hydrogen bond acceptor counts are present in 2-Phenylthiazolidine-4-carboxylic acid methyl ester?
There are 4 hydrogen bond acceptor counts in 2-Phenylthiazolidine-4-carboxylic acid methyl ester.
What is the topological polar surface area of 2-Phenylthiazolidine-4-carboxylic acid methyl ester?
The topological polar surface area of 2-Phenylthiazolidine-4-carboxylic acid methyl ester is 63.6 Å2.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
CAS
99387-89-0 Purity
---
99387-89-0 Purity
---
