99-14-9 Purity
98%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C9H15N3O5.
The compound was created on 2005-08-08 and modified on 2023-12-30.
The IUPAC name of the compound is 2-[[(2R)-2-acetamido-3-methylbutanoyl]-nitrosoamino]acetic acid.
The InChIKey of the compound is XZUXDHWLWRENOL-MRVPVSSYSA-N.
The Canonical SMILES of the compound is CC(C)C(C(=O)N(CC(=O)O)N=O)NC(=O)C.
The molecular weight of the compound is 245.23 g/mol.
The compound has 2 hydrogen bond donor counts.
The compound has 6 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 116 Å2.
Yes, the compound is canonicalized.