CAS
99102-22-4 Purity
90%+
99102-22-4 Purity
90%+
Inquiry Basket
3-[(E)-3-(1H-Indol-6-yl)-1,1-dimethyl-2-propenyl]-7-(3-methyl-2-butenyl)-1H-indole
CAS
99102-34-8
Catalog Number
ACM99102348
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C26H28N2.
What is the PubChem CID of the compound?
The PubChem CID of the compound is 90477927.
What is the molecular weight of the compound?
The molecular weight of the compound is 368.5 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 3-[(E)-4-(1H-indol-6-yl)-2-methylbut-3-en-2-yl]-7-(3-methylbut-2-enyl)-1H-indole.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C26H28N2/c1-18(2)8-10-21-6-5-7-22-23(17-28-25(21)22)26(3,4)14-12-19-9-11-20-13-15-27-24(20)16-19/h5-9,11-17,27-28H,10H2,1-4H3/b14-12+.
What is the InChIKey of the compound?
The InChIKey of the compound is QLEWZPONEOHLMI-WYMLVPIESA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC(=CCC1=C2C(=CC=C1)C(=CN2)C(C)(C)C=CC3=CC4=C(C=C3)C=CN4)C.
What is the isomeric SMILES of the compound?
The isomeric SMILES of the compound is CC(=CCC1=C2C(=CC=C1)C(=CN2)C(C)(C)/C=C/C3=CC4=C(C=C3)C=CN4)C.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 7.5.
Does the compound have any hydrogen bond acceptor count?
No, the compound does not have any hydrogen bond acceptor count.
Recommended Products
![3-[1-(1H-Indol-3-yl)-3-methyl-2-butenyl]-7-(3-methyl-2-butenyl)-1H-indole](https://resource.alfa-chemistry.com/structure/99102-31-5.gif)
CAS
99102-31-5 Purity
---
99102-31-5 Purity
---
