What is the molecular formula of Acetamide,N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-?
The molecular formula is C10H12N2O3.
What is the molecular weight of Acetamide,N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)?
The molecular weight is 208.21 g/mol.
What is the IUPAC name of Acetamide,N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)?
The IUPAC name is N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide.
What is the InChI of Acetamide,N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)?
The InChI is InChI=1S/C10H12N2O3/c1-6(13)12-8-5-10-9(4-7(8)11)14-2-3-15-10/h4-5H,2-3,11H2,1H3,(H,12,13).
How many hydrogen bond donor counts does Acetamide,N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)- have?
It has 2 hydrogen bond donor counts.
What is the XLogP3-AA value of Acetamide, N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)?
The XLogP3-AA value is 0.1.
How many hydrogen bond acceptor counts does Acetamide, N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl) have?
It has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of Acetamide, N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)?
The topological polar surface area is 73.6 Ų.
How many rotatable bond counts does Acetamide, N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl) have?
It has 1 rotatable bond count.
Is Acetamide, N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl) a canonicalized compound?
Yes, it is a canonicalized compound.