99688-43-4 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 3-[2-carboxyethyl(nitro)amino]propanoic acid.
The InChI of the compound is InChI=1S/C6H10N2O6/c9-5(10)1-3-7(8(13)14)4-2-6(11)12/h1-4H2,(H,9,10)(H,11,12).
The InChIKey of the compound is MXPYFZODOSRODU-UHFFFAOYSA-N.
The molecular weight of the compound is 206.15 g/mol.
The XLogP3-AA value of the compound is -0.4.
The compound has 2 hydrogen bond donor counts.
The compound has 7 hydrogen bond acceptor counts.
The compound has 6 rotatable bond counts.
The exact mass of the compound is 206.05388604 g/mol.
Yes, the compound is canonicalized.