What is the molecular formula of Methyl 6-[(aminocarbonothioyl)amino]hexanoate?
The molecular formula is C8H16N2O2S.
What are the synonyms for Methyl 6-[(aminocarbonothioyl)amino]hexanoate?
The synonyms are methyl 6-(carbamothioylamino)hexanoate, Methyl 6-thioureidohexanoate, and Methyl6-thioureidohexanoate.
What is the molecular weight of Methyl 6-[(aminocarbonothioyl)amino]hexanoate?
The molecular weight is 204.29 g/mol.
What is the IUPAC Name of Methyl 6-[(aminocarbonothioyl)amino]hexanoate?
The IUPAC Name is methyl 6-(carbamothioylamino)hexanoate.
What is the InChI of Methyl 6-[(aminocarbonothioyl)amino]hexanoate?
The InChI is InChI=1S/C8H16N2O2S/c1-12-7(11)5-3-2-4-6-10-8(9)13/h2-6H2,1H3,(H3,9,10,13).
What is the InChIKey of Methyl 6-[(aminocarbonothioyl)amino]hexanoate?
The InChIKey is VALKJAZBWIWNGX-UHFFFAOYSA-N.
What is the canonical SMILES of Methyl 6-[(aminocarbonothioyl)amino]hexanoate?
The canonical SMILES is COC(=O)CCCCCNC(=S)N.
What is the XLogP3-AA value of Methyl 6-[(aminocarbonothioyl)amino]hexanoate?
The XLogP3-AA value is 0.5.
How many hydrogen bond donor counts does Methyl 6-[(aminocarbonothioyl)amino]hexanoate have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Methyl 6-[(aminocarbonothioyl)amino]hexanoate have?
It has 3 hydrogen bond acceptor counts.