CAS
98877-82-8 Purity
---
98877-82-8 Purity
---
Inquiry Basket
1,2-Dimethyl-3-propylimidazolium chloride
CAS
98892-74-1
Catalog Number
ACM98892741
Category
Other Products
Molecular Weight
174.6711
Molecular Formula
C8H15ClN2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
1,2-DIMETHYL-3-PROPYLIMIDAZOLIUM CHLORIDE
What is the molecular formula of 1,2-Dimethyl-3-propylimidazolium chloride?
The molecular formula of 1,2-Dimethyl-3-propylimidazolium chloride is C8H15ClN2.
What is the molecular weight of 1,2-Dimethyl-3-propylimidazolium chloride?
The molecular weight of 1,2-Dimethyl-3-propylimidazolium chloride is 174.67 g/mol.
What is the IUPAC name of 1,2-Dimethyl-3-propylimidazolium chloride?
The IUPAC name of 1,2-Dimethyl-3-propylimidazolium chloride is 1,2-dimethyl-3-propylimidazol-1-ium;chloride.
What is the InChIKey of 1,2-Dimethyl-3-propylimidazolium chloride?
The InChIKey of 1,2-Dimethyl-3-propylimidazolium chloride is OJIJIFAYAIXTGP-UHFFFAOYSA-M.
What is the canonical SMILES representation of 1,2-Dimethyl-3-propylimidazolium chloride?
The canonical SMILES representation of 1,2-Dimethyl-3-propylimidazolium chloride is CCCN1C=C[N+](=C1C)C.[Cl-].
How many hydrogen bond donor counts does 1,2-Dimethyl-3-propylimidazolium chloride have?
1,2-Dimethyl-3-propylimidazolium chloride has 0 hydrogen bond donor counts.
How many rotatable bond counts does 1,2-Dimethyl-3-propylimidazolium chloride have?
1,2-Dimethyl-3-propylimidazolium chloride has 2 rotatable bond counts.
What is the exact mass of 1,2-Dimethyl-3-propylimidazolium chloride?
The exact mass of 1,2-Dimethyl-3-propylimidazolium chloride is 174.0923762 g/mol.
Does 1,2-Dimethyl-3-propylimidazolium chloride have any defined atom stereocenter counts?
No, 1,2-Dimethyl-3-propylimidazolium chloride does not have any defined atom stereocenter counts.
Is the compound canonicalized for 1,2-Dimethyl-3-propylimidazolium chloride?
Yes, the compound is canonicalized for 1,2-Dimethyl-3-propylimidazolium chloride.
Recommended Products
