CAS
98845-19-3 Purity
---
98845-19-3 Purity
---
Inquiry Basket
Cyclopropanecarboxylic acid ethyl ester
CAS
988537
Catalog Number
ACM988537
Category
Other Products
Molecular Formula
C6H10O2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
Cyclopropanecarboxylic acid ethyl ester;Ethyl cyclopropanecarboxylate
What is the molecular formula of Cyclopropanecarboxylic acid ethyl ester?
The molecular formula of Cyclopropanecarboxylic acid ethyl ester is C6H10O2.
What is the molecular weight of Cyclopropanecarboxylic acid ethyl ester?
The molecular weight of Cyclopropanecarboxylic acid ethyl ester is 114.14 g/mol.
What is the IUPAC name of Cyclopropanecarboxylic acid ethyl ester?
The IUPAC name of Cyclopropanecarboxylic acid ethyl ester is ethyl cyclopropanecarboxylate.
What is the InChI of Cyclopropanecarboxylic acid ethyl ester?
The InChI of Cyclopropanecarboxylic acid ethyl ester is InChI=1S/C6H10O2/c1-2-8-6(7)5-3-4-5/h5H,2-4H2,1H3.
What is the InChIKey of Cyclopropanecarboxylic acid ethyl ester?
The InChIKey of Cyclopropanecarboxylic acid ethyl ester is LDDOSDVZPSGLFZ-UHFFFAOYSA-N.
What is the canonical SMILES of Cyclopropanecarboxylic acid ethyl ester?
The canonical SMILES of Cyclopropanecarboxylic acid ethyl ester is CCOC(=O)C1CC1.
What is the CAS number of Cyclopropanecarboxylic acid ethyl ester?
The CAS number of Cyclopropanecarboxylic acid ethyl ester is 4606-07-9.
What is the European Community (EC) number of Cyclopropanecarboxylic acid ethyl ester?
The European Community (EC) number of Cyclopropanecarboxylic acid ethyl ester is 225-010-4.
What is the hydrogen bond donor count of Cyclopropanecarboxylic acid ethyl ester?
The hydrogen bond donor count of Cyclopropanecarboxylic acid ethyl ester is 0.
What is the hydrogen bond acceptor count of Cyclopropanecarboxylic acid ethyl ester?
The hydrogen bond acceptor count of Cyclopropanecarboxylic acid ethyl ester is 2.
Recommended Products
![N-[2-(Dimethylamino)-2-oxoethyl]-N-(4-ethoxyphenyl)benzamide](https://resource.alfa-chemistry.com/structure/98845-19-3.gif)
CAS
98849-86-6 Purity
---
98849-86-6 Purity
---
