What is the molecular formula of 5-Hydroxy-1-methyl-1H-imidazole-4-carboxylic acid methyl ester?
The molecular formula is C6H8N2O3.
What is the molecular weight of 5-Hydroxy-1-methyl-1H-imidazole-4-carboxylic acid methyl ester?
The molecular weight is 156.14 g/mol.
When was 5-Hydroxy-1-methyl-1H-imidazole-4-carboxylic acid methyl ester created in PubChem?
It was created on 2005-03-26.
What is the InChI of 5-Hydroxy-1-methyl-1H-imidazole-4-carboxylic acid methyl ester?
The InChI is InChI=1S/C6H8N2O3/c1-8-3-7-4(5(8)9)6(10)11-2/h3,9H,1-2H3.
What is the Canonical SMILES of 5-Hydroxy-1-methyl-1H-imidazole-4-carboxylic acid methyl ester?
The Canonical SMILES is CN1C=NC(=C1O)C(=O)OC.
How many Hydrogen Bond Donor Counts does 5-Hydroxy-1-methyl-1H-imidazole-4-carboxylic acid methyl ester have?
It has 1 Hydrogen Bond Donor Count.
What is the Hydrogen Bond Acceptor Count of 5-Hydroxy-1-methyl-1H-imidazole-4-carboxylic acid methyl ester?
It has 4 Hydrogen Bond Acceptor Count.
What is the Rotatable Bond Count of 5-Hydroxy-1-methyl-1H-imidazole-4-carboxylic acid methyl ester?
It has 2 Rotatable Bond Count.
What is the Topological Polar Surface Area of 5-Hydroxy-1-methyl-1H-imidazole-4-carboxylic acid methyl ester?
The Topological Polar Surface Area is 64.4 Ų.
Is 5-Hydroxy-1-methyl-1H-imidazole-4-carboxylic acid methyl ester a Canonicalized compound?
Yes, it is a Canonicalized compound.