CAS
98736-50-6 Purity
---
98736-50-6 Purity
---
Shopping basket
tert-Butyl 7-hydroxy-1H-indole-1-carboxylate
CAS
98746-78-6
Catalog Number
ACM98746786
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of tert-Butyl 7-hydroxy-1H-indole-1-carboxylate?
The molecular formula of tert-Butyl 7-hydroxy-1H-indole-1-carboxylate is C13H15NO3.
What is the molecular weight of tert-Butyl 7-hydroxy-1H-indole-1-carboxylate?
The molecular weight of tert-Butyl 7-hydroxy-1H-indole-1-carboxylate is 233.26 g/mol.
What is the IUPAC name of tert-Butyl 7-hydroxy-1H-indole-1-carboxylate?
The IUPAC name of tert-Butyl 7-hydroxy-1H-indole-1-carboxylate is tert-butyl 7-hydroxyindole-1-carboxylate.
What is the InChIKey of tert-Butyl 7-hydroxy-1H-indole-1-carboxylate?
The InChIKey of tert-Butyl 7-hydroxy-1H-indole-1-carboxylate is AXJXBZZOZPYABA-UHFFFAOYSA-N.
What is the Canonical SMILES of tert-Butyl 7-hydroxy-1H-indole-1-carboxylate?
The Canonical SMILES of tert-Butyl 7-hydroxy-1H-indole-1-carboxylate is CC(C)(C)OC(=O)N1C=CC2=C1C(=CC=C2)O.
How many hydrogen bond donor counts are in tert-Butyl 7-hydroxy-1H-indole-1-carboxylate?
There is 1 hydrogen bond donor count in tert-Butyl 7-hydroxy-1H-indole-1-carboxylate.
What is the topological polar surface area of tert-Butyl 7-hydroxy-1H-indole-1-carboxylate?
The topological polar surface area of tert-Butyl 7-hydroxy-1H-indole-1-carboxylate is 51.5 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
How many rotatable bond counts are in tert-Butyl 7-hydroxy-1H-indole-1-carboxylate?
There are 2 rotatable bond counts in tert-Butyl 7-hydroxy-1H-indole-1-carboxylate.
What is the XLogP3-AA value of tert-Butyl 7-hydroxy-1H-indole-1-carboxylate?
The XLogP3-AA value of tert-Butyl 7-hydroxy-1H-indole-1-carboxylate is 2.9.
Recommended Products
![N-[(4-Bromophenyl)methyl]-N-methyl-nitrous amide](https://resource.alfa-chemistry.com/structure/98736-50-6.gif)
![tert-Butyl[s-(r*,r*)]-(-)-(1-oxiranyl-2-phenylethyl)carbamate](https://resource.alfa-chemistry.com/structure/98737-29-2.gif)
CAS
98737-29-2 Purity
98%
98737-29-2 Purity
98%
CAS
98751-93-0 Purity
---
98751-93-0 Purity
---
