What is the molecular formula of 1H-Pyrazole-4-carboxaldehyde, 5-methyl-1-phenyl?
The molecular formula is C11H10N2O.
What is the molecular weight of 1H-Pyrazole-4-carboxaldehyde, 5-methyl-1-phenyl?
The molecular weight is 186.21 g/mol
What is the IUPAC name of 1H-Pyrazole-4-carboxaldehyde, 5-methyl-1-phenyl?
The IUPAC name is 5-methyl-1-phenylpyrazole-4-carbaldehyde.
What is the InChI of 1H-Pyrazole-4-carboxaldehyde, 5-methyl-1-phenyl?
The InChI is InChI=1S/C11H10N2O/c1-9-10(8-14)7-12-13(9)11-5-3-2-4-6-11/h2-8H,1H3.
What is the InChIKey of 1H-Pyrazole-4-carboxaldehyde, 5-methyl-1-phenyl?
The InChIKey is IIEFFVFWBUGUTI-UHFFFAOYSA-N.
What is the Canonical SMILES of 1H-Pyrazole-4-carboxaldehyde, 5-methyl-1-phenyl?
The Canonical SMILES is CC1=C(C=NN1C2=CC=CC=C2)C=O.
What is the CAS number for 1H-Pyrazole-4-carboxaldehyde, 5-methyl-1-phenyl?
The CAS number is 98700-50-6.
How many hydrogen bond acceptors are there in 1H-Pyrazole-4-carboxaldehyde, 5-methyl-1-phenyl?
There are 2 hydrogen bond acceptors.
What is the topological polar surface area of 1H-Pyrazole-4-carboxaldehyde, 5-methyl-1-phenyl?
The topological polar surface area is 34.9 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.