98656-57-6 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C16H25NO4.
The molecular weight of the compound is 295.37 g/mol.
The IUPAC name of the compound is 2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)propane-1,3-diol.
The InChI representation of the compound is InChI=1S/C16H25NO4/c1-3-20-14-7-11-5-6-17-16(12(9-18)10-19)13(11)8-15(14)21-4-2/h7-8,12,16-19H,3-6,9-10H2,1-2H3.
The InChIKey of the compound is DLPCTIQNIDHILA-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCOC1=C(C=C2C(NCCC2=C1)C(CO)CO)OCC.
The XLogP3-AA value of the compound is 0.9.
The compound has 3 hydrogen bond donor counts.
The compound has 5 hydrogen bond acceptor counts.
Yes, the compound is canonicalized.