What is the molecular formula of ethyl 5-cyano-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylate?
The molecular formula is C13H10FN3O2.
When was ethyl 5-cyano-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylate created and modified in PubChem?
It was created on 2007-02-08 and modified on 2023-12-30.
What is the IUPAC name of ethyl 5-cyano-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylate?
The IUPAC name is ethyl 5-cyano-1-(4-fluorophenyl)pyrazole-4-carboxylate.
What is the InChIKey of ethyl 5-cyano-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylate?
The InChIKey is CTNNDBIRJRSKJF-UHFFFAOYSA-N.
What is the canonical SMILES representation of ethyl 5-cyano-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylate?
The canonical SMILES is CCOC(=O)C1=C(N(N=C1)C2=CC=C(C=C2)F)C#N.
What is the molecular weight of ethyl 5-cyano-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylate?
The molecular weight is 259.24 g/mol.
How many hydrogen bond acceptors are present in ethyl 5-cyano-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylate?
There are 5 hydrogen bond acceptors.
What is the topological polar surface area of ethyl 5-cyano-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylate?
The topological polar surface area is 67.9 Ų.
How many rotatable bonds are in ethyl 5-cyano-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylate?
There are 4 rotatable bonds.
Is ethyl 5-cyano-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylate a canonicalized compound in PubChem?
Yes, it is a canonicalized compound in PubChem.