98-45-3 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 5-(4-chlorobutyl)-1-(4-phenylmethoxycyclohexyl)tetrazole.
The InChI of the compound is InChI=1S/C18H25ClN4O/c19-13-5-4-8-18-20-21-22-23(18)16-9-11-17(12-10-16)24-14-15-6-2-1-3-7-15/h1-3,6-7,16-17H,4-5,8-14H2.
The InChIKey of the compound is OMZLTMKDYUJXTQ-UHFFFAOYSA-N.
The Canonical SMILES of the compound is C1CC(CCC1N2C(=NN=N2)CCCCCl)OCC3=CC=CC=C3.
The molecular weight of the compound is 348.9 g/mol.
The compound has 0 Hydrogen Bond Donor Count.
The topological polar surface area of the compound is 52.8 Ų.
The compound has 8 rotatable bond count.
Yes, the compound is canonicalized.
The XLogP3-AA value of the compound is 3.7.