98326-29-5 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H13ClN2S.
The molecular weight of the compound is 228.74 g/mol.
The IUPAC name of the compound is 2-chloro-6-piperidin-4-ylsulfanylpyridine.
The compound is represented by the Canonical SMILES: C1CNCCC1SC2=NC(=CC=C2)Cl.
The CAS number of the compound is 98330-05-3.
The XLogP3-AA value of the compound is 2.8.
The compound has 1 hydrogen bond donor count.
The compound has 3 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 50.2 ?^2.
Yes, the compound is canonicalized.