98317-60-3 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C6H5NO3.
The synonyms of the compound are 4-Hydroxypicolinic acid, 4-hydroxypyridine-2-carboxylic acid, and 4-oxo-1,4-dihydropyridine-2-carboxylic acid.
The molecular weight of the compound is 139.11 g/mol.
The IUPAC name of the compound is 4-oxo-1H-pyridine-2-carboxylic acid.
The InChI of the compound is InChI=1S/C6H5NO3/c8-4-1-2-7-5(3-4)6(9)10/h1-3H,(H,7,8)(H,9,10).
The InChIKey of the compound is MXXLHBCSVDDTIX-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CNC(=CC1=O)C(=O)O.
The CAS number of the compound is 22468-26-4.
The EC number of the compound is 688-036-9.
Yes, the compound is canonicalized.