CAS
98-30-7 Purity
---
98-30-7 Purity
---
If you have any other questions or need other size, please get a quote.
The molecular formula is C6H7NS2.
The molecular weight is 157.3 g/mol.
It was created on 2007-12-05.
The IUPAC Name is 6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazole.
The InChI is InChI=1S/C6H7NS2/c1-2-8-3-6-5(1)7-4-9-6/h4H,1-3H2.
It has 0 hydrogen bond donor counts.
The topological polar surface area is 66.4 Ų.
There are 9 heavy atoms present.
Yes, it is considered canonicalized.
The exact mass is 157.00199157 g/mol.