98279-87-9 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2-Chloro-cyclohexylammonium chloride is C6H13Cl2N.
The molecular weight of 2-Chloro-cyclohexylammonium chloride is 170.08 g/mol.
The IUPAC name of 2-Chloro-cyclohexylammonium chloride is (2-chlorocyclohexyl)azanium;chloride.
The InChI of 2-Chloro-cyclohexylammonium chloride is InChI=1S/C6H12ClN.ClH/c7-5-3-1-2-4-6(5)8;/h5-6H,1-4,8H2;1H.
The InChIKey of 2-Chloro-cyclohexylammonium chloride is FTFJHAZPJYUWPR-UHFFFAOYSA-N.
The canonical SMILES of 2-Chloro-cyclohexylammonium chloride is C1CCC(C(C1)[NH3+])Cl.[Cl-].
The hydrogen bond donor count of 2-Chloro-cyclohexylammonium chloride is 1.
The hydrogen bond acceptor count of 2-Chloro-cyclohexylammonium chloride is 1.
The rotatable bond count of 2-Chloro-cyclohexylammonium chloride is 0.
Yes, 2-Chloro-cyclohexylammonium chloride is a canonicalized compound.