98197-08-1 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C6H7ClN2O2.
The IUPAC name of the compound is 4-chloro-2,5-dimethylpyrazole-3-carboxylic acid.
The InChI of the compound is InChI=1S/C6H7ClN2O2/c1-3-4(7)5(6(10)11)9(2)8-3/h1-2H3,(H,10,11).
The InChIKey of the compound is BSCNPVBDEITWDU-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=NN(C(=C1Cl)C(=O)O)C.
The molecular weight of the compound is 174.58 g/mol.
The CAS number of the compound is 98198-65-3.
The EC number of the compound is 673-158-7.
The XLogP3-AA value of the compound is 1.1.
Yes, the compound is canonically represented.