What is the molecular formula of 4,6-Dichloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidine?
The molecular formula is C6H4Cl2N4.
What is the IUPAC name of 4,6-Dichloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidine?
The IUPAC name is 4,6-dichloro-1-methylpyrazolo[3,4-d]pyrimidine.
What is the InChIKey of 4,6-Dichloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidine?
The InChIKey is TYMWHTJGWKSXRY-UHFFFAOYSA-N.
What is the canonical SMILES of 4,6-Dichloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidine?
The canonical SMILES is CN1C2=C(C=N1)C(=NC(=N2)Cl)Cl.
What is the CAS number of 4,6-Dichloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidine?
The CAS number is 98141-42-5.
What is the molecular weight of 4,6-Dichloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidine?
The molecular weight is 203.03 g/mol.
How many hydrogen bond acceptor counts does 4,6-Dichloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidine have?
It has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of 4,6-Dichloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidine?
The topological polar surface area is 43.6 Ų.
How many heavy atoms are present in the chemical structure of 4,6-Dichloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidine?
There are 12 heavy atoms.
Is 4,6-Dichloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidine classified as a canonicalized compound?
Yes, it is classified as a canonicalized compound.