98088-04-1 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
1-prop-2-enoxybut-3-enylbenzene.
The molecular weight of the compound is 188.26 g/mol.
The InChI of the compound is InChI=1S/C13H16O/c1-3-8-13(14-11-4-2)12-9-6-5-7-10-12/h3-7,9-10,13H,1-2,8,11H2.
The InChIKey of the compound is VQJJJPBNIXFEFB-UHFFFAOYSA-N.
The canonical SMILES of the compound is C=CCC(C1=CC=CC=C1)OCC=C.
The CAS number of the compound is 98088-48-3.
The XLogP3-AA value of the compound is 3.4.
The compound has 0 hydrogen bond donor counts.
The compound has 6 rotatable bond counts.
Yes, the compound is canonicalized.