What is the molecular formula of 2(Bromomethyl)-2-methyl-3-methylenecyclopentaneacetic acid?
The molecular formula is C10H15BrO2.
What is the molecular weight of 2(Bromomethyl)-2-methyl-3-methylenecyclopentaneacetic acid?
The molecular weight is 247.13 g/mol.
What is the IUPAC name of 2(Bromomethyl)-2-methyl-3-methylenecyclopentaneacetic acid?
The IUPAC name is 2-[2-(bromomethyl)-2-methyl-3-methylidenecyclopentyl]acetic acid.
What is the InChI of 2(Bromomethyl)-2-methyl-3-methylenecyclopentaneacetic acid?
The InChI is InChI=1S/C10H15BrO2/c1-7-3-4-8(5-9(12)13)10(7,2)6-11/h8H,1,3-6H2,2H3,(H,12,13).
What is the InChIKey of 2(Bromomethyl)-2-methyl-3-methylenecyclopentaneacetic acid?
The InChIKey is IACANXNJBCAXBM-UHFFFAOYSA-N.
What is the canonical SMILES of 2(Bromomethyl)-2-methyl-3-methylenecyclopentaneacetic acid?
The canonical SMILES is CC1(C(CCC1=C)CC(=O)O)CBr.
What is the XLogP3-AA value of 2(Bromomethyl)-2-methyl-3-methylenecyclopentaneacetic acid?
The XLogP3-AA value is 2.4.
How many hydrogen bond donor counts does 2(Bromomethyl)-2-methyl-3-methylenecyclopentaneacetic acid have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2(Bromomethyl)-2-methyl-3-methylenecyclopentaneacetic acid have?
It has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does 2(Bromomethyl)-2-methyl-3-methylenecyclopentaneacetic acid have?
It has 3 rotatable bond counts.