98674-86-3 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2-Iodobenzoic acid is C7H5IO2.
The molecular weight of 2-Iodobenzoic acid is 248.02 g/mol.
The IUPAC name of 2-Iodobenzoic acid is 2-iodobenzoic acid.
The InChI of 2-Iodobenzoic acid is InChI=1S/C7H5IO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10).
The InChIKey of 2-Iodobenzoic acid is CJNZAXGUTKBIHP-UHFFFAOYSA-N.
The canonical SMILES of 2-Iodobenzoic acid is C1=CC=C(C(=C1)C(=O)O)I.
The CAS number of 2-Iodobenzoic acid is 88-67-5.
The ChEMBL ID of 2-Iodobenzoic acid is CHEMBL112424.
The molecular weight of 2-Iodobenzoic acid is 248.02 g/mol.
The hydrogen bond donor count of 2-Iodobenzoic acid is 1.