98-25-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The PubChem CID of 2,6-Diaminotoluene-4-sulfonic acid is 66812.
The molecular formula of 2,6-Diaminotoluene-4-sulfonic acid is C7H10N2O3S.
The molecular weight of 2,6-Diaminotoluene-4-sulfonic acid is 202.23 g/mol.
The IUPAC name of 2,6-Diaminotoluene-4-sulfonic acid is 3,5-diamino-4-methylbenzenesulfonic acid.
The InChI of 2,6-Diaminotoluene-4-sulfonic acid is InChI=1S/C7H10N2O3S/c1-4-6(8)2-5(3-7(4)9)13(10,11)12/h2-3H,8-9H2,1H3,(H,10,11,12).
The InChIKey of 2,6-Diaminotoluene-4-sulfonic acid is IPQWXJDRMKGSFI-UHFFFAOYSA-N.
The canonical SMILES of 2,6-Diaminotoluene-4-sulfonic acid is CC1=C(C=C(C=C1N)S(=O)(=O)O)N.
The CAS number of 2,6-Diaminotoluene-4-sulfonic acid is 98-25-9.
The European Community (EC) number of 2,6-Diaminotoluene-4-sulfonic acid is 202-649-7.
Yes, 2,6-Diaminotoluene-4-sulfonic acid is a canonicalized compound.