97944-41-7 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2-Chloro-5-methyl-4-nitropyridine is C6H5ClN2O2.
The molecular weight of 2-Chloro-5-methyl-4-nitropyridine is 172.57 g/mol.
2-Chloro-5-methyl-4-nitropyridine was created on February 8, 2007.
The InChIKey of 2-Chloro-5-methyl-4-nitropyridine is PEGDFBBVKXPIME-UHFFFAOYSA-N.
The Canonical SMILES of 2-Chloro-5-methyl-4-nitropyridine is CC1=CN=C(C=C1[N+](=O)[O-])Cl.
The topological polar surface area of 2-Chloro-5-methyl-4-nitropyridine is 58.7 Ų.
There are 3 hydrogen bond acceptors in 2-Chloro-5-methyl-4-nitropyridine.
Yes, 2-Chloro-5-methyl-4-nitropyridine is considered as a canonicalized compound on PubChem.
The XLogP3-AA value of 2-Chloro-5-methyl-4-nitropyridine is 2.
There are 0 rotatable bond counts in 2-Chloro-5-methyl-4-nitropyridine.