What is the molecular formula of Ethylenediaminetetraacetic acid trisodium salt trihydrate?
The molecular formula is C10H19N2Na3O11.
What is the molecular weight of Ethylenediaminetetraacetic acid trisodium salt trihydrate?
The molecular weight is 412.23 g/mol.
What is the IUPAC name of Ethylenediaminetetraacetic acid trisodium salt trihydrate?
The IUPAC name is trisodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate;trihydrate.
What is the InChI of Ethylenediaminetetraacetic acid trisodium salt trihydrate?
The InChI is InChI=1S/C10H16N2O8.3Na.3H2O/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;;3*1H2/q;3*+1;;;/p-3.
What is the InChIKey of Ethylenediaminetetraacetic acid trisodium salt trihydrate?
The InChIKey is FXNQQEVEDZAAJM-UHFFFAOYSA-K.
What is the Canonical SMILES representation of Ethylenediaminetetraacetic acid trisodium salt trihydrate?
The Canonical SMILES is C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)[O-].O.O.O.[Na+].[Na+].[Na+].
How many hydrogen bond donor counts does Ethylenediaminetetraacetic acid trisodium salt trihydrate have?
It has 4 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Ethylenediaminetetraacetic acid trisodium salt trihydrate have?
It has 13 hydrogen bond acceptor counts.
How many rotatable bond counts does Ethylenediaminetetraacetic acid trisodium salt trihydrate have?
It has 8 rotatable bond counts.
What is the topological polar surface area of Ethylenediaminetetraacetic acid trisodium salt trihydrate?
The topological polar surface area is 167 ?2.