CAS
97909-54-1 Purity
96%
97909-54-1 Purity
96%
Inquiry Basket
4-Chloro-2-(difluoromethoxy)benzoic acid
CAS
97914-60-8
Catalog Number
ACM97914608
Category
Other Products
Molecular Formula
C8H5ClF2O3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-chloro-2-(difluoromethoxy)benzoic acid.
What is the molecular formula of the compound?
The molecular formula of the compound is C8H5ClF2O3.
What is the molecular weight of the compound?
The molecular weight of the compound is 222.57 g/mol.
What is the InChIKey of the compound?
The InChIKey of the compound is HGASHYZSZYKNEH-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=C(C=C1Cl)OC(F)F)C(=O)O.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
What is the XLogP3 value of the compound?
The XLogP3 value of the compound is 2.9.
How many hydrogen bond acceptor counts does the compound have?
The compound has 5 hydrogen bond acceptor counts.
What is the exact mass of the compound?
The exact mass of the compound is 221.9895280 g/mol.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![[Bis-(3-aminopropyl)]polydimethylsiloxane](https://resource.alfa-chemistry.com/structure/97917-34-5.gif)
